CAS 1555363-27-3 is the registry number for 4-(6-Methoxypyridin-3-yl)phenol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(6-methoxy-3-pyridinyl)phenol (CAS 1555363-27-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 4-(6-methoxy-3-pyridinyl)phenol. InChIKey: ACKKXJFBNSXZBZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 4-(6-methoxy-3-pyridinyl)phenol |
| InChIKey | ACKKXJFBNSXZBZ-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)