CAS 18159-22-3 appears in our catalog under these names: 1-Benzylpyrrole-2-carboxylic acid, 97%, 1–Benzyl–1H–pyrrole–2–carboxylic acid, 1-Benzyl-1H-pyrrole-2-carboxylic acid, 1-Benzyl-1H-pyrrole-2-carboxylic acid 97%, 1-Benzyl-1H-pyrrole-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 0,5g.
1-benzylpyrrole-2-carboxylic acid (CAS 18159-22-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 1-benzylpyrrole-2-carboxylic acid. InChIKey: OGGDCEFWAMGBOB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-benzylpyrrole-2-carboxylic acid |
| InChIKey | OGGDCEFWAMGBOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC=C2C(=O)O |
Computed by PubChem (NCBI)