CAS 139927-26-7 is the registry number for 3,3-Dimethyl-3,4-dihydro-1h-furo[3,4-b]indol-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
3,3-dimethyl-4H-furo[3,4-b]indol-1-one (CAS 139927-26-7) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 3,3-dimethyl-4H-furo[3,4-b]indol-1-one. InChIKey: IUQMLSKLAUMFEM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3,3-dimethyl-4H-furo[3,4-b]indol-1-one |
| InChIKey | IUQMLSKLAUMFEM-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C3=CC=CC=C3N2)C(=O)O1)C |
Computed by PubChem (NCBI)