Products 10447-29-7

CAS 10447-29-7 is the registry number for Ethyl quinoline-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl quinoline-4-carboxylate (CAS 10447-29-7) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: ethyl quinoline-4-carboxylate. InChIKey: FJWYVZDPWAPMGN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO2
Molecular weight201.22 g/mol
IUPAC nameethyl quinoline-4-carboxylate
InChIKeyFJWYVZDPWAPMGN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=NC2=CC=CC=C12

Computed by PubChem (NCBI)