cas: 525-64-4 — see every product listed under this CAS number, including other names
2,7-Diaminofluorene, >98.0%(HPLC) (CAS 525-64-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0092-1G |
| cas | 525-64-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 295.37 Pln | |
| TCI | 5g | 905.11 Pln | |
| TCI | 25g | 2847.42 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
9H-fluorene-2,7-diamine (CAS 525-64-4) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 9H-fluorene-2,7-diamine. InChIKey: SNCJAJRILVFXAE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 9H-fluorene-2,7-diamine |
| InChIKey | SNCJAJRILVFXAE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)C3=C1C=C(C=C3)N |
Computed by PubChem (NCBI)