cas: 525-64-4 — see every product listed under this CAS number, including other names
9H-Fluorene-2,7-diamine, 98%, 98% (CAS 525-64-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DEFT-250mg |
| cas | 525-64-4 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1182.80 Pln | |
| Chemat | 25g | 4634.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9H-fluorene-2,7-diamine (CAS 525-64-4) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 9H-fluorene-2,7-diamine. InChIKey: SNCJAJRILVFXAE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 9H-fluorene-2,7-diamine |
| InChIKey | SNCJAJRILVFXAE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)C3=C1C=C(C=C3)N |
Computed by PubChem (NCBI)