cas: 85575-93-5 — see every product listed under this CAS number, including other names
2,9-Dibutyl-1,10-phenanthroline 98% (CAS 85575-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103709-100mg |
| cas | 85575-93-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 2445.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A103709 |
2,9-dibutyl-1,10-phenanthroline (CAS 85575-93-5) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: 2,9-dibutyl-1,10-phenanthroline. InChIKey: LSGGPELKXXFMGO-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2,9-dibutyl-1,10-phenanthroline |
| InChIKey | LSGGPELKXXFMGO-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(C=CC3=C2N=C(C=C3)CCCC)C=C1 |
Computed by PubChem (NCBI)