cas: 85575-93-5 — see every product listed under this CAS number, including other names
2,9-Dibutyl-1,10-phenanthroline, 98%, 98% (CAS 85575-93-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G8E-5g |
| cas | 85575-93-5 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1394.00 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 328.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,9-dibutyl-1,10-phenanthroline (CAS 85575-93-5) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: 2,9-dibutyl-1,10-phenanthroline. InChIKey: LSGGPELKXXFMGO-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 2,9-dibutyl-1,10-phenanthroline |
| InChIKey | LSGGPELKXXFMGO-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2=C(C=CC3=C2N=C(C=C3)CCCC)C=C1 |
Computed by PubChem (NCBI)