cas: 5447-87-0 — see every product listed under this CAS number, including other names
2–(1–Phenylethylidene)malononitrile (CAS 5447-87-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF42359-100mg |
| cas | 5447-87-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 526.83 Pln | |
| GLPBio | 1g | 840.43 Pln | |
| GLPBio | 250mg | 583.00 Pln | |
| GLPBio | 5g | 1785.89 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(1-phenylethylidene)propanedinitrile (CAS 5447-87-0) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 2-(1-phenylethylidene)propanedinitrile. InChIKey: ZVOMMPYHGITOEF-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 2-(1-phenylethylidene)propanedinitrile |
| InChIKey | ZVOMMPYHGITOEF-UHFFFAOYSA-N |
| SMILES | CC(=C(C#N)C#N)C1=CC=CC=C1 |
Computed by PubChem (NCBI)