Products 85452-79-5
CAS 85452-79-5 appears in our catalog under these names: (Z)-3-(1H-Indol-3-yl)acrylonitrile, 95%, (Z)–3–(1H–Indol–3–yl)acrylonitrile, (Z)-3-(1H-Indol-3-yl)acrylonitrile. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(Z)-3-(1H-indol-3-yl)prop-2-enenitrile (CAS 85452-79-5) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: (Z)-3-(1H-indol-3-yl)prop-2-enenitrile. InChIKey: GQCABHQDRZQIOP-ARJAWSKDSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (Z)-3-(1H-indol-3-yl)prop-2-enenitrile |
| InChIKey | GQCABHQDRZQIOP-ARJAWSKDSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=C\C#N |
Computed by PubChem (NCBI)