cas: 10262-65-4 — see every product listed under this CAS number, including other names
2–(Bromoacetyl)–6–methoxynaphthalene (CAS 10262-65-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD03608-1g |
| cas | 10262-65-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 774.90 Pln | |
| GLPBio | 250mg | 545.55 Pln | |
| GLPBio | 25g | 4247.83 Pln | |
| GLPBio | 5g | 1500.38 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-1-(6-methoxynaphthalen-2-yl)ethanone (CAS 10262-65-4) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: 2-bromo-1-(6-methoxynaphthalen-2-yl)ethanone. InChIKey: HHHKEQGAGUAOQI-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 2-bromo-1-(6-methoxynaphthalen-2-yl)ethanone |
| InChIKey | HHHKEQGAGUAOQI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)