Products 150256-18-1

CAS 150256-18-1 is the registry number for Ethyl 5-bromo-2-naphthoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 5-bromonaphthalene-2-carboxylate (CAS 150256-18-1) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 5-bromonaphthalene-2-carboxylate. InChIKey: AFTPDXYWGRVXEE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BrO2
Molecular weight279.13 g/mol
IUPAC nameethyl 5-bromonaphthalene-2-carboxylate
InChIKeyAFTPDXYWGRVXEE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=C1)C(=CC=C2)Br

Computed by PubChem (NCBI)