cas: 7144-65-2 — see every product listed under this CAS number, including other names
2-(((1,1'-Biphenyl)-2-yloxy)methyl)oxirane, 95% (CAS 7144-65-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A524782-25g |
| cas | 7144-65-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 6163.36 Pln | |
| AmBeed | 5g | 1847.23 Pln | |
| AmBeed | 1g | 577.78 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(2-phenylphenoxy)methyl]oxirane (CAS 7144-65-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2-[(2-phenylphenoxy)methyl]oxirane. InChIKey: DNVXWIINBUTFEP-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-[(2-phenylphenoxy)methyl]oxirane |
| InChIKey | DNVXWIINBUTFEP-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC=CC=C2C3=CC=CC=C3 |
Computed by PubChem (NCBI)