cas: 7144-65-2 — see every product listed under this CAS number, including other names
2-Biphenylyl Glycidyl Ether, 98%, 98% (CAS 7144-65-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116HSR-25g |
| cas | 7144-65-2 |
| size | 25g |
| availability | 4000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 357.20 Pln | |
| Chemat | 500g | 1502.40 Pln | |
| Chemat | 5g | 93.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[(2-phenylphenoxy)methyl]oxirane (CAS 7144-65-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2-[(2-phenylphenoxy)methyl]oxirane. InChIKey: DNVXWIINBUTFEP-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-[(2-phenylphenoxy)methyl]oxirane |
| InChIKey | DNVXWIINBUTFEP-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC=CC=C2C3=CC=CC=C3 |
Computed by PubChem (NCBI)