cas: 4515-21-3 — see every product listed under this CAS number, including other names
2-(((Benzyloxy)carbonyl)amino)succinic acid, 98% (CAS 4515-21-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F455008-25G |
| cas | 4515-21-3 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 383.22 Pln | |
| Fluorochem | 250g | 872.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(phenylmethoxycarbonylamino)butanedioic acid (CAS 4515-21-3) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)butanedioic acid. InChIKey: XYXYXSKSTZAEJW-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)butanedioic acid |
| InChIKey | XYXYXSKSTZAEJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)