CAS 4515-21-3 appears in our catalog under these names: Z–DL–Asp–OH, N-(Benzyloxycarbonyl)-DL-aspartic acid, 98%, 98%, 2-(((Benzyloxy)carbonyl)amino)succinic acid, 98%, Cbz-DL-Asp-OH, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 500g, 250g.
2-(phenylmethoxycarbonylamino)butanedioic acid (CAS 4515-21-3) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)butanedioic acid. InChIKey: XYXYXSKSTZAEJW-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)butanedioic acid |
| InChIKey | XYXYXSKSTZAEJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)