Products 1446429-04-4

CAS 1446429-04-4 is the registry number for Pentanedioic acid, 1-(2,5-dioxo-1-pyrrolidinyl) 5-(2-propyn-1-yl) ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-prop-2-ynyl pentanedioate (CAS 1446429-04-4) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-prop-2-ynyl pentanedioate. InChIKey: WLKPJMUUDOZGMX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO6
Molecular weight267.23 g/mol
IUPAC name5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-prop-2-ynyl pentanedioate
InChIKeyWLKPJMUUDOZGMX-UHFFFAOYSA-N
SMILESC#CCOC(=O)CCCC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)