Products 385375-27-9
CAS 385375-27-9 appears in our catalog under these names: 5-Methyl-2-(4-nitrophenyl)-1,3-dioxane-5-carboxylic acid, 95%, 5-Methyl-2-(4-nitrophenyl)-1,3-dioxane-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-methyl-2-(4-nitrophenyl)-1,3-dioxane-5-carboxylic acid (CAS 385375-27-9) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: 5-methyl-2-(4-nitrophenyl)-1,3-dioxane-5-carboxylic acid. InChIKey: RHBFUMRYUOSFNM-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | 5-methyl-2-(4-nitrophenyl)-1,3-dioxane-5-carboxylic acid |
| InChIKey | RHBFUMRYUOSFNM-UHFFFAOYSA-N |
| SMILES | CC1(COC(OC1)C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)