Products 62351-79-5

CAS 62351-79-5 is the registry number for Apremilast Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.

Diethyl 3-nitrobenzene-1,2-dicarboxylate (CAS 62351-79-5) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: diethyl 3-nitrobenzene-1,2-dicarboxylate. InChIKey: XPSYMRWVHURDQP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO6
Molecular weight267.23 g/mol
IUPAC namediethyl 3-nitrobenzene-1,2-dicarboxylate
InChIKeyXPSYMRWVHURDQP-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C(=O)OCC

Computed by PubChem (NCBI)