CAS 62351-79-5 is the registry number for Apremilast Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 3-nitrobenzene-1,2-dicarboxylate (CAS 62351-79-5) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: diethyl 3-nitrobenzene-1,2-dicarboxylate. InChIKey: XPSYMRWVHURDQP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | diethyl 3-nitrobenzene-1,2-dicarboxylate |
| InChIKey | XPSYMRWVHURDQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)