CAS 78663-07-7 appears in our catalog under these names: Z-D-Asp-OH, 95%, N-Carbobenzyloxy-D-aspartic Acid, Z–D–Asp–OH, Z-D-Asp-OH, N-Carbobenzoxy-D-aspartic Acid, >98.0%(T). Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, TCI. Available pack sizes: 5g, 100g, 500g, 25g, 1g, 10g, 1000g, 1kg.
(2R)-2-(phenylmethoxycarbonylamino)butanedioic acid (CAS 78663-07-7) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)butanedioic acid. InChIKey: XYXYXSKSTZAEJW-SECBINFHSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)butanedioic acid |
| InChIKey | XYXYXSKSTZAEJW-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)