cas: 71904-80-8 — see every product listed under this CAS number, including other names
2-(((tert-Butoxycarbonyl)amino)methyl)thiazole-4-carboxylic acid 98+% (CAS 71904-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A259756-100mg |
| cas | 71904-80-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 715.25 Pln | |
| Ambeed | 1g | 1799.94 Pln | |
| Ambeed | 5g | 5259.81 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A259756 |
2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid (CAS 71904-80-8) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: RKTDDQLCSYDRLH-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | RKTDDQLCSYDRLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC(=CS1)C(=O)O |
Computed by PubChem (NCBI)