cas: 129101-25-3 — see every product listed under this CAS number, including other names
2-((Tert-Butoxycarbonyl)Amino)-3-(4-Fluorophenyl)Propanoic Acid, 98%, 98% (CAS 129101-25-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YUT-1g |
| cas | 129101-25-3 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 621.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 129101-25-3) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: 3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RCXSXRAUMLKRRL-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RCXSXRAUMLKRRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)