CAS 41153-30-4 appears in our catalog under these names: Boc–Phe(4–F)–OH, Boc-L-4-fluorophenylalanine, 98%, Boc-L-Phe(4-F)-OH, Boc-Phe(4-F)-OH, 98%, 98%, N-(tert-Butoxycarbonyl)-4-fluoro-L-phenylalanine, >98.0%(T). Offered by: GLPBio, Fluorochem, Iris Biotech, Chemat, TCI. Available pack sizes: 10g, 25g, 1g, 5g, 100g, 250g, 250mg, 100 g.
(2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 41153-30-4) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RCXSXRAUMLKRRL-NSHDSACASA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RCXSXRAUMLKRRL-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)