CAS 57292-45-2 appears in our catalog under these names: Boc–D–Phe(4–F)–OH, Boc-D-Phe(4-F)-OH, N-(tert-Butoxycarbonyl)-4-fluoro-D-phenylalanine, >98.0%(T), Boc-D-Phe(4-F)-OH, 95%, 95%, (R)-2-((tert-Butoxycarbonyl)amino)-3-(4-fluorophenyl)propanoic acid, 99.49%. Offered by: GLPBio, Iris Biotech, TCI, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 25 g, 10 g, 5 g.
(2R)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 57292-45-2) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2R)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RCXSXRAUMLKRRL-LLVKDONJSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2R)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RCXSXRAUMLKRRL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)