cas: 39274-53-8 — see every product listed under this CAS number, including other names
2-((Tert-butoxycarbonyl)amino)-2-(3-hydroxyphenyl)acetic acid, 97% (CAS 39274-53-8) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F773633-500MG |
| cas | 39274-53-8 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1101.71 Pln | |
| Fluorochem | 1g | 1611.95 Pln | |
| Fluorochem | 5g | 4699.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 39274-53-8) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: 2-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: OWZGHJNAVZKAIL-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 2-(3-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | OWZGHJNAVZKAIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC(=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)