cas: 209525-73-5 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-2-(4-chlorophenyl)acetic acid, 97%, 97% (CAS 209525-73-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113KA6-250mg |
| cas | 209525-73-5 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 472.40 Pln | |
| Chemat | 10g | 842.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 209525-73-5) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZZONJNNLTAGSHB-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZZONJNNLTAGSHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)