cas: 209525-73-5 — see every product listed under this CAS number, including other names
2–((tert–Butoxycarbonyl)amino)–2–(4–chlorophenyl)acetic acid (CAS 209525-73-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB53473-10g |
| cas | 209525-73-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1982.47 Pln | |
| GLPBio | 1g | 634.48 Pln | |
| GLPBio | 25g | 4318.04 Pln | |
| GLPBio | 5g | 1280.39 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 209525-73-5) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZZONJNNLTAGSHB-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZZONJNNLTAGSHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)