cas: 119363-63-2 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-3,3-diphenylpropanoic acid, 97% (CAS 119363-63-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A147730-250mg |
| cas | 119363-63-2 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1593.34 Pln | |
| AmBeed | 1g | 3110.17 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid (CAS 119363-63-2) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid. InChIKey: TYJDOLCFYZSNQC-UHFFFAOYSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid |
| InChIKey | TYJDOLCFYZSNQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(C1=CC=CC=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)