CAS 117027-46-0 appears in our catalog under these names: Boc–3,3–diphenyl–D–alanine, Boc-d-3,3-diphenylalanine, ≥98%, ≥98%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid (CAS 117027-46-0) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid. InChIKey: TYJDOLCFYZSNQC-QGZVFWFLSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid |
| InChIKey | TYJDOLCFYZSNQC-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(C1=CC=CC=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)