CAS 138662-63-2 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–3,3–diphenylpropanoic acid, N-Boc-3,3-diphenyl-L-alanine, 95% , BOC-BETA-PHENYL-PHE-OH, >=98.0%, (S)-2-((Tert-Butoxycarbonyl)Amino)-3,3-Diphenylpropanoic Acid, 98%, 98%, (S)-N-Boc-2-Amino-3,3-diphenylpropionic acid, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid (CAS 138662-63-2) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid. InChIKey: TYJDOLCFYZSNQC-KRWDZBQOSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid |
| InChIKey | TYJDOLCFYZSNQC-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(C1=CC=CC=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)