cas: 851653-36-6 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid, 97% (CAS 851653-36-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F761538-250MG |
| cas | 851653-36-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 919.49 Pln | |
| Fluorochem | 1g | 2887.54 Pln | |
| Fluorochem | 5g | 13107.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 851653-36-6) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VCDQZVYJKDSORW-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VCDQZVYJKDSORW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CN(C)C)C(=O)O |
Computed by PubChem (NCBI)