cas: 109007-59-2 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-3-(thiophen-3-yl)propanoic acid, 97% (CAS 109007-59-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A532652-5g |
| cas | 109007-59-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6925.03 Pln | |
| AmBeed | 25g | 20635.09 Pln | |
| Fluorochem | 1g | 950.72 Pln | |
| Fluorochem | 5g | 2720.93 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid (CAS 109007-59-2) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid. InChIKey: SIQSLARNSCAXSF-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropanoic acid |
| InChIKey | SIQSLARNSCAXSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CSC=C1)C(=O)O |
Computed by PubChem (NCBI)