CAS 438532-52-6 appears in our catalog under these names: 2-Ethyl 4-isopropyl 5-amino-3-methylthiophene-2,4-dicarboxylate, 95%, 2-Ethyl 4-isopropyl 5-amino-3-methylthiophene-2,4-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-O-ethyl 4-O-propan-2-yl 5-amino-3-methylthiophene-2,4-dicarboxylate (CAS 438532-52-6) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 2-O-ethyl 4-O-propan-2-yl 5-amino-3-methylthiophene-2,4-dicarboxylate. InChIKey: KXNVWYCVOIHAOB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 2-O-ethyl 4-O-propan-2-yl 5-amino-3-methylthiophene-2,4-dicarboxylate |
| InChIKey | KXNVWYCVOIHAOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(S1)N)C(=O)OC(C)C)C |
Computed by PubChem (NCBI)