CAS 785792-44-1 appears in our catalog under these names: 3-[(Mesitylsulfonyl)amino]propanoic acid, 95%, 3-(2,4,6-Trimethylbenzenesulfonamido)propanoic acid, 95%, 3-(2,4,6-Trimethylbenzenesulfonamido)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid (CAS 785792-44-1) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid. InChIKey: VWWUPADKTAUKGJ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 3-[(2,4,6-trimethylphenyl)sulfonylamino]propanoic acid |
| InChIKey | VWWUPADKTAUKGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NCCC(=O)O)C |
Computed by PubChem (NCBI)