Products 1049806-52-1

CAS 1049806-52-1 is the registry number for N-(2,5-Dimethylphenyl)-n-(methylsulfonyl)alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2,5-dimethyl-N-methylsulfonylanilino)propanoic acid (CAS 1049806-52-1) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 2-(2,5-dimethyl-N-methylsulfonylanilino)propanoic acid. InChIKey: MZJMDMIADHZPOT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO4S
Molecular weight271.33 g/mol
IUPAC name2-(2,5-dimethyl-N-methylsulfonylanilino)propanoic acid
InChIKeyMZJMDMIADHZPOT-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)N(C(C)C(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)