Products 425617-51-2

CAS 425617-51-2 is the registry number for N-(4-Isopropylphenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(N-methylsulfonyl-4-propan-2-ylanilino)acetic acid (CAS 425617-51-2) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 2-(N-methylsulfonyl-4-propan-2-ylanilino)acetic acid. InChIKey: ORSPQAVZZZOWQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO4S
Molecular weight271.33 g/mol
IUPAC name2-(N-methylsulfonyl-4-propan-2-ylanilino)acetic acid
InChIKeyORSPQAVZZZOWQZ-UHFFFAOYSA-N
SMILESCC(C)C1=CC=C(C=C1)N(CC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)