Products 313259-91-5
CAS 313259-91-5 is the registry number for 3-[(Diethylamino)sulfonyl]-4-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(diethylsulfamoyl)-4-methylbenzoic acid (CAS 313259-91-5) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 3-(diethylsulfamoyl)-4-methylbenzoic acid. InChIKey: GAJSSAJVKXGWLX-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 3-(diethylsulfamoyl)-4-methylbenzoic acid |
| InChIKey | GAJSSAJVKXGWLX-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=C(C=CC(=C1)C(=O)O)C |
Computed by PubChem (NCBI)