cas: 55954-27-3 — see every product listed under this CAS number, including other names
2-(2,4-Dichlorophenyl)acetamide, 98%, 98% (CAS 55954-27-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKRI-250mg |
| cas | 55954-27-3 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1086.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,4-dichlorophenyl)acetamide (CAS 55954-27-3) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)acetamide. InChIKey: NAYAHQPYRSIGCX-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)acetamide |
| InChIKey | NAYAHQPYRSIGCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC(=O)N |
Computed by PubChem (NCBI)