CAS 33244-92-7 appears in our catalog under these names: 3,5-Dichloro-n-methylbenzamide, 95%, 3,5-Dichloro-N-methylbenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3,5-dichloro-N-methylbenzamide (CAS 33244-92-7) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 3,5-dichloro-N-methylbenzamide. InChIKey: BICUCGPTPDFRIK-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 3,5-dichloro-N-methylbenzamide |
| InChIKey | BICUCGPTPDFRIK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)