CAS 66896-64-8 appears in our catalog under these names: 2,4-Dichloro-n-methylbenzamide, 95%, 2,4-Dichloro-N-methylbenzamide 95+%, Benzamide, 2,4-dichloro-N-methyl-, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 50mg, 10mg, 25mg, 100mg.
2,4-dichloro-N-methylbenzamide (CAS 66896-64-8) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 2,4-dichloro-N-methylbenzamide. InChIKey: LHGOQNXBLLXSIZ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2,4-dichloro-N-methylbenzamide |
| InChIKey | LHGOQNXBLLXSIZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)