Products 1213494-33-7
CAS 1213494-33-7 is the registry number for (3R)-6,7-Dichloro-2,3-dihydrobenzo[b]furan-3-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3R)-6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine (CAS 1213494-33-7) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: (3R)-6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: URMAYQIYUBDETJ-LURJTMIESA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | (3R)-6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | URMAYQIYUBDETJ-LURJTMIESA-N |
| SMILES | C1[C@@H](C2=C(O1)C(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)