CAS 175278-27-0 is the registry number for 2,4-Dichloro-6-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,4-dichloro-6-methylbenzamide (CAS 175278-27-0) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 2,4-dichloro-6-methylbenzamide. InChIKey: VFEDGRKNPQMLEP-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2,4-dichloro-6-methylbenzamide |
| InChIKey | VFEDGRKNPQMLEP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)