CAS 1415596-09-6 is the registry number for 2-Amino-4,5-dichloro-3-methylbenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-4,5-dichloro-3-methylbenzaldehyde (CAS 1415596-09-6) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 2-amino-4,5-dichloro-3-methylbenzaldehyde. InChIKey: RKWAPJBZRDBXLJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2-amino-4,5-dichloro-3-methylbenzaldehyde |
| InChIKey | RKWAPJBZRDBXLJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)Cl)C=O)N |
Computed by PubChem (NCBI)