cas: 770719-22-7 — see every product listed under this CAS number, including other names
2-(2,5-Difluoro-4-nitrophenyl)acetic Acid 95% (CAS 770719-22-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A292605-100mg |
| cas | 770719-22-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 3018.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A292605 |
2-(2,5-difluoro-4-nitrophenyl)acetic acid (CAS 770719-22-7) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(2,5-difluoro-4-nitrophenyl)acetic acid. InChIKey: TVRVWDBXMJDAKV-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(2,5-difluoro-4-nitrophenyl)acetic acid |
| InChIKey | TVRVWDBXMJDAKV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])F)CC(=O)O |
Computed by PubChem (NCBI)