CAS 1000339-22-9 appears in our catalog under these names: 2-(4,5-Difluoro-2-nitrophenyl)acetic acid, 97%, 2–(4,5–Difluoro–2–nitrophenyl)acetic acid, 2-(4,5-Difluoro-2-nitrophenyl)acetic acid 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-(4,5-difluoro-2-nitrophenyl)acetic acid (CAS 1000339-22-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(4,5-difluoro-2-nitrophenyl)acetic acid. InChIKey: MKRFZKGJZRUCEG-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(4,5-difluoro-2-nitrophenyl)acetic acid |
| InChIKey | MKRFZKGJZRUCEG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)