Products 543683-36-9

CAS 543683-36-9 appears in our catalog under these names: (2,6-Difluoro-4-nitrophenyl)acetic acid, 96%, (2,6-DIfluoro-4-nitrophenyl)acetic acid, 95%, 2-(2,6-Difluoro-4-nitrophenyl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2,6-difluoro-4-nitrophenyl)acetic acid (CAS 543683-36-9) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(2,6-difluoro-4-nitrophenyl)acetic acid. InChIKey: MDMRXAYFALTPII-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F2NO4
Molecular weight217.13 g/mol
IUPAC name2-(2,6-difluoro-4-nitrophenyl)acetic acid
InChIKeyMDMRXAYFALTPII-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)CC(=O)O)F)[N+](=O)[O-]

Computed by PubChem (NCBI)