Products 770719-22-7
CAS 770719-22-7 appears in our catalog under these names: 2-(2,5-Difluoro-4-nitrophenyl)acetic acid, 95%, 2–(2，5–Difluoro–4–nitrophenyl)acetic Acid, 2-(2,5-Difluoro-4-nitrophenyl)acetic Acid 95%, 2-(2，5-Difluoro-4-nitrophenyl)acetic Acid, 95%, 95%, 2-(2,5-DIFLUORO-4-NITROPHENYL)ACETIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(2,5-difluoro-4-nitrophenyl)acetic acid (CAS 770719-22-7) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2-(2,5-difluoro-4-nitrophenyl)acetic acid. InChIKey: TVRVWDBXMJDAKV-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2-(2,5-difluoro-4-nitrophenyl)acetic acid |
| InChIKey | TVRVWDBXMJDAKV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])F)CC(=O)O |
Computed by PubChem (NCBI)