CAS 1803730-28-0 appears in our catalog under these names: Methyl 2,5-difluoro-6-nitrobenzoate, 95%, Methyl 3,6-difluoro-2-nitrobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 3,6-difluoro-2-nitrobenzoate (CAS 1803730-28-0) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: methyl 3,6-difluoro-2-nitrobenzoate. InChIKey: PSZJMAZVCNQMSH-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | methyl 3,6-difluoro-2-nitrobenzoate |
| InChIKey | PSZJMAZVCNQMSH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)