Products 206360-56-7
CAS 206360-56-7 appears in our catalog under these names: Difluoro(4-nitrophenyl)acetic acid, 95-<97%, 2，2–difluoro–2–(4–nitrophenyl)acetic acid, 2,2-Difluoro-2-(4-nitrophenyl)acetic acid 95%, 2,2-Difluoro-2-(4-nitrophenyl)acetic Acid, 95%, 95%, 2,2-Difluoro-2-(4-nitrophenyl)acetic acid, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100mg, 1g, 250mg.
2,2-difluoro-2-(4-nitrophenyl)acetic acid (CAS 206360-56-7) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2,2-difluoro-2-(4-nitrophenyl)acetic acid. InChIKey: RZESONLWCQFNHX-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-nitrophenyl)acetic acid |
| InChIKey | RZESONLWCQFNHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)