2-(2,6-Dichlorophenoxy)acetyl chloride, 97%
cas: 20143-46-8 — see every product listed under this CAS number, including other names
2-(2,6-Dichlorophenoxy)acetyl chloride, 97% (CAS 20143-46-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A618346-250mg |
| cas | 20143-46-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1115.75 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1278.80 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 397.66 Pln | |
| BLDpharm | 5g | 1197.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(2,6-dichlorophenoxy)acetyl chloride (CAS 20143-46-8) is a chemical compound with the molecular formula C8H5Cl3O2 and a molecular weight of 239.5 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)acetyl chloride. InChIKey: RPNBBIYJWHBRED-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O2 |
|---|---|
| Molecular weight | 239.5 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)acetyl chloride |
| InChIKey | RPNBBIYJWHBRED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC(=O)Cl)Cl |
Computed by PubChem (NCBI)